C30H31N3O3S — CID 3184897
N-cyclohexyl-2-(4-methoxyphenyl)-2-[quinolin-3-yl-(2-thiophen-2-ylacetyl)amino]acetamide (PubChem CID 3184897) has the molecular formula C30H31N3O3S and a molecular weight of 513.66 g/mol. Its IUPAC name is N-cyclohexyl-2-(4-methoxyphenyl)-2-[quinolin-3-yl-(2-thiophen-2-ylacetyl)amino]acetamide.
| Compound Name | N-cyclohexyl-2-(4-methoxyphenyl)-2-[quinolin-3-yl-(2-thiophen-2-ylacetyl)amino]acetamide |
|---|---|
| PubChem CID | 3184897 |
| Molecular Formula | C30H31N3O3S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | N-cyclohexyl-2-(4-methoxyphenyl)-2-[quinolin-3-yl-(2-thiophen-2-ylacetyl)amino]acetamide |
| SMILES | COc1ccc(C(C(=O)NC2CCCCC2)N(C(=O)Cc2cccs2)c2cnc3ccccc3c2)cc1 |
| InChI | InChI=1S/C30H31N3O3S/c1-36-25-15-13-21(14-16-25)29(30(35)32-23-9-3-2-4-10-23)33(28(34)19-26-11-7-17-37-26)24-18-22-8-5-6-12-27(22)31-20-24/h5-8,11-18,20,23,29H,2-4,9-10,19H2,1H3,(H,32,35) |
| InChIKey | OKNQKITXFAYEIF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |