C23H30FN3O4S2 — CID 3185234
1-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]sulfonyl-4-(2-fluorophenyl)piperazine (PubChem CID 3185234) has the molecular formula C23H30FN3O4S2 and a molecular weight of 495.64 g/mol. Its IUPAC name is 1-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]sulfonyl-4-(2-fluorophenyl)piperazine.
| Compound Name | 1-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]sulfonyl-4-(2-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 3185234 |
| Molecular Formula | C23H30FN3O4S2 |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 1-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]sulfonyl-4-(2-fluorophenyl)piperazine |
| SMILES | CCC1CCCCN1S(=O)(=O)c1ccc(S(=O)(=O)N2CCN(c3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C23H30FN3O4S2/c1-2-19-7-5-6-14-27(19)33(30,31)21-12-10-20(11-13-21)32(28,29)26-17-15-25(16-18-26)23-9-4-3-8-22(23)24/h3-4,8-13,19H,2,5-7,14-18H2,1H3 |
| InChIKey | TYHQDNJIKMELMB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |