C21H21N5O5 — CID 31871909
N-(3-cyclopentyloxy-4-methoxyphenyl)-3-nitro-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 31871909) has the molecular formula C21H21N5O5 and a molecular weight of 423.43 g/mol. Its IUPAC name is N-(3-cyclopentyloxy-4-methoxyphenyl)-3-nitro-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-(3-cyclopentyloxy-4-methoxyphenyl)-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 31871909 |
| Molecular Formula | C21H21N5O5 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | N-(3-cyclopentyloxy-4-methoxyphenyl)-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(-n3cncn3)c([N+](=O)[O-])c2)cc1OC1CCCC1 |
| InChI | InChI=1S/C21H21N5O5/c1-30-19-9-7-15(11-20(19)31-16-4-2-3-5-16)24-21(27)14-6-8-17(18(10-14)26(28)29)25-13-22-12-23-25/h6-13,16H,2-5H2,1H3,(H,24,27) |
| InChIKey | HBDDXWLNGXSDHS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|