C12H17N5OS — CID 31887726
5-hydrazinyl-11-propyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 31887726) has the molecular formula C12H17N5OS and a molecular weight of 279.37 g/mol. Its IUPAC name is 5-hydrazinyl-11-propyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 5-hydrazinyl-11-propyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 31887726 |
| Molecular Formula | C12H17N5OS |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 5-hydrazinyl-11-propyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | CCCN1CCc2c(sc3nc(NN)[nH]c(=O)c23)C1 |
| InChI | InChI=1S/C12H17N5OS/c1-2-4-17-5-3-7-8(6-17)19-11-9(7)10(18)14-12(15-11)16-13/h2-6,13H2,1H3,(H2,14,15,16,18) |
| InChIKey | XBNMHTLFUCGOEI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|