C20H19N3OS — CID 31903464
4-[(2,6-dimethylpyrimidin-4-yl)sulfanylmethyl]-N-phenylbenzamide (PubChem CID 31903464) has the molecular formula C20H19N3OS and a molecular weight of 349.46 g/mol. Its IUPAC name is 4-[(2,6-dimethylpyrimidin-4-yl)sulfanylmethyl]-N-phenylbenzamide.
| Compound Name | 4-[(2,6-dimethylpyrimidin-4-yl)sulfanylmethyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 31903464 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 4-[(2,6-dimethylpyrimidin-4-yl)sulfanylmethyl]-N-phenylbenzamide |
| SMILES | Cc1cc(SCc2ccc(C(=O)Nc3ccccc3)cc2)nc(C)n1 |
| InChI | InChI=1S/C20H19N3OS/c1-14-12-19(22-15(2)21-14)25-13-16-8-10-17(11-9-16)20(24)23-18-6-4-3-5-7-18/h3-12H,13H2,1-2H3,(H,23,24) |
| InChIKey | JYYKAXPPDPWKHA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |