C20H29N5OS2 — CID 3193148
N-(3-methoxypropyl)-4-(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazine-1-carbothioamide (PubChem CID 3193148) has the molecular formula C20H29N5OS2 and a molecular weight of 419.62 g/mol. Its IUPAC name is N-(3-methoxypropyl)-4-(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazine-1-carbothioamide.
| Compound Name | N-(3-methoxypropyl)-4-(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3193148 |
| Molecular Formula | C20H29N5OS2 |
| Molecular Weight | 419.62 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N-(3-methoxypropyl)-4-(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazine-1-carbothioamide |
| SMILES | COCCCNC(=S)N1CCN(c2nc(C)nc3sc4c(c23)CCCC4)CC1 |
| InChI | InChI=1S/C20H29N5OS2/c1-14-22-18(17-15-6-3-4-7-16(15)28-19(17)23-14)24-9-11-25(12-10-24)20(27)21-8-5-13-26-2/h3-13H2,1-2H3,(H,21,27) |
| InChIKey | CQOUGDAGLWXNRD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.62 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|