C18H13ClN4OS2 — CID 31987707
2-(2-chlorophenyl)-5-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanylmethyl)-1,3,4-oxadiazole (PubChem CID 31987707) has the molecular formula C18H13ClN4OS2 and a molecular weight of 400.92 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-5-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanylmethyl)-1,3,4-oxadiazole.
| Compound Name | 2-(2-chlorophenyl)-5-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanylmethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 31987707 |
| Molecular Formula | C18H13ClN4OS2 |
| Molecular Weight | 400.92 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | 2-(2-chlorophenyl)-5-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanylmethyl)-1,3,4-oxadiazole |
| SMILES | Clc1ccccc1-c1nnc(CSc2ncnc3sc4c(c23)CCC4)o1 |
| InChI | InChI=1S/C18H13ClN4OS2/c19-12-6-2-1-4-10(12)16-23-22-14(24-16)8-25-17-15-11-5-3-7-13(11)26-18(15)21-9-20-17/h1-2,4,6,9H,3,5,7-8H2 |
| InChIKey | GPGATUYCARWINZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.92 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |