C22H22N4O4S2 — CID 4856924
2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanylmethyl)-5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazole (PubChem CID 4856924) has the molecular formula C22H22N4O4S2 and a molecular weight of 470.58 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanylmethyl)-5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanylmethyl)-5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 4856924 |
| Molecular Formula | C22H22N4O4S2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanylmethyl)-5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazole |
| SMILES | COc1cc(-c2nnc(CSc3ncnc4sc5c(c34)CCCC5)o2)cc(OC)c1OC |
| InChI | InChI=1S/C22H22N4O4S2/c1-27-14-8-12(9-15(28-2)19(14)29-3)20-26-25-17(30-20)10-31-21-18-13-6-4-5-7-16(13)32-22(18)24-11-23-21/h8-9,11H,4-7,10H2,1-3H3 |
| InChIKey | NWAKLYBYMRCYIG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 92.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |