C22H22N4OS2 — CID 3200155
2-[(2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-5-(4-methylphenyl)-1,3,4-oxadiazole (PubChem CID 3200155) has the molecular formula C22H22N4OS2 and a molecular weight of 422.58 g/mol. Its IUPAC name is 2-[(2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-5-(4-methylphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[(2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-5-(4-methylphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 3200155 |
| Molecular Formula | C22H22N4OS2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-[(2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-5-(4-methylphenyl)-1,3,4-oxadiazole |
| SMILES | Cc1ccc(-c2nnc(CSc3nc(C)nc4sc5c(c34)CCC(C)C5)o2)cc1 |
| InChI | InChI=1S/C22H22N4OS2/c1-12-4-7-15(8-5-12)20-26-25-18(27-20)11-28-21-19-16-9-6-13(2)10-17(16)29-22(19)24-14(3)23-21/h4-5,7-8,13H,6,9-11H2,1-3H3 |
| InChIKey | LOAOZVSVNWUJKT-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |