C15H16N4OS3 — CID 17417889
2-(methylsulfanylmethyl)-5-[(7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]-1,3,4-oxadiazole (PubChem CID 17417889) has the molecular formula C15H16N4OS3 and a molecular weight of 364.52 g/mol. Its IUPAC name is 2-(methylsulfanylmethyl)-5-[(7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-(methylsulfanylmethyl)-5-[(7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 17417889 |
| Molecular Formula | C15H16N4OS3 |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 2-(methylsulfanylmethyl)-5-[(7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]-1,3,4-oxadiazole |
| SMILES | CSCc1nnc(Sc2ncnc3sc4c(c23)CCC(C)C4)o1 |
| InChI | InChI=1S/C15H16N4OS3/c1-8-3-4-9-10(5-8)22-13-12(9)14(17-7-16-13)23-15-19-18-11(20-15)6-21-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | IOPRGFBPBQAVID-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |