C16H16N4OS2 — CID 17402653
2-cyclopropyl-5-[(7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]-1,3,4-oxadiazole (PubChem CID 17402653) has the molecular formula C16H16N4OS2 and a molecular weight of 344.47 g/mol. Its IUPAC name is 2-cyclopropyl-5-[(7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-cyclopropyl-5-[(7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 17402653 |
| Molecular Formula | C16H16N4OS2 |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2-cyclopropyl-5-[(7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]-1,3,4-oxadiazole |
| SMILES | CC1CCc2c(sc3ncnc(Sc4nnc(C5CC5)o4)c23)C1 |
| InChI | InChI=1S/C16H16N4OS2/c1-8-2-5-10-11(6-8)22-14-12(10)15(18-7-17-14)23-16-20-19-13(21-16)9-3-4-9/h7-9H,2-6H2,1H3 |
| InChIKey | TUFMGYURIJHJHS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |