C16H17N5S3 — CID 9336994
5-[[(7S)-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine (PubChem CID 9336994) has the molecular formula C16H17N5S3 and a molecular weight of 375.55 g/mol. Its IUPAC name is 5-[[(7S)-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[[(7S)-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 9336994 |
| Molecular Formula | C16H17N5S3 |
| Molecular Weight | 375.55 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 5-[[(7S)-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine |
| SMILES | C=CCNc1nnc(Sc2ncnc3sc4c(c23)CC[C@H](C)C4)s1 |
| InChI | InChI=1S/C16H17N5S3/c1-3-6-17-15-20-21-16(24-15)23-14-12-10-5-4-9(2)7-11(10)22-13(12)18-8-19-14/h3,8-9H,1,4-7H2,2H3,(H,17,20)/t9-/m0/s1 |
| InChIKey | HKLJYKWIRAUYIE-VIFPVBQESA-N |
| XLogP | 4.42 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|