C15H15N5S3 — CID 9336948
5-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-yl)sulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine (PubChem CID 9336948) has the molecular formula C15H15N5S3 and a molecular weight of 361.52 g/mol. Its IUPAC name is 5-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-yl)sulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-yl)sulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 9336948 |
| Molecular Formula | C15H15N5S3 |
| Molecular Weight | 361.52 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 5-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-yl)sulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine |
| SMILES | C=CCNc1nnc(Sc2nc(C)nc3sc4c(c23)CCC4)s1 |
| InChI | InChI=1S/C15H15N5S3/c1-3-7-16-14-19-20-15(23-14)22-13-11-9-5-4-6-10(9)21-12(11)17-8(2)18-13/h3H,1,4-7H2,2H3,(H,16,19) |
| InChIKey | QLYQKMUZFLIHOM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|