C16H19N5OS3 — CID 9336449
N-(2-methoxyethyl)-5-[[(7S)-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]-1,3,4-thiadiazol-2-amine (PubChem CID 9336449) has the molecular formula C16H19N5OS3 and a molecular weight of 393.56 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5-[[(7S)-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(2-methoxyethyl)-5-[[(7S)-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 9336449 |
| Molecular Formula | C16H19N5OS3 |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N-(2-methoxyethyl)-5-[[(7S)-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]-1,3,4-thiadiazol-2-amine |
| SMILES | COCCNc1nnc(Sc2ncnc3sc4c(c23)CC[C@H](C)C4)s1 |
| InChI | InChI=1S/C16H19N5OS3/c1-9-3-4-10-11(7-9)23-13-12(10)14(19-8-18-13)24-16-21-20-15(25-16)17-5-6-22-2/h8-9H,3-7H2,1-2H3,(H,17,20)/t9-/m0/s1 |
| InChIKey | FWNIQBYGZIPSQQ-VIFPVBQESA-N |
| XLogP | 3.88 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|