C21H22N6OS2 — CID 24565685
4-[[4-(2-methoxyethyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine (PubChem CID 24565685) has the molecular formula C21H22N6OS2 and a molecular weight of 438.58 g/mol. Its IUPAC name is 4-[[4-(2-methoxyethyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine.
| Compound Name | 4-[[4-(2-methoxyethyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 24565685 |
| Molecular Formula | C21H22N6OS2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 4-[[4-(2-methoxyethyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
| SMILES | COCCn1c(Sc2ncnc3sc4c(c23)CCC(C)C4)nnc1-c1ccncc1 |
| InChI | InChI=1S/C21H22N6OS2/c1-13-3-4-15-16(11-13)29-19-17(15)20(24-12-23-19)30-21-26-25-18(27(21)9-10-28-2)14-5-7-22-8-6-14/h5-8,12-13H,3-4,9-11H2,1-2H3 |
| InChIKey | XPWOIETVHUFOJU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |