C20H19N5OS2 — CID 38834124
2-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 38834124) has the molecular formula C20H19N5OS2 and a molecular weight of 409.54 g/mol. Its IUPAC name is 2-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 38834124 |
| Molecular Formula | C20H19N5OS2 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 2-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1ccc(-c2nnc(CSc3nc(N)c4c5c(sc4n3)CCCC5)o2)cc1 |
| InChI | InChI=1S/C20H19N5OS2/c1-11-6-8-12(9-7-11)18-25-24-15(26-18)10-27-20-22-17(21)16-13-4-2-3-5-14(13)28-19(16)23-20/h6-9H,2-5,10H2,1H3,(H2,21,22,23) |
| InChIKey | YOUIOJKAMYQPOS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 90.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |