C18H19N3S2 — CID 697187
10-[(2,4-dimethylphenyl)methylsulfanyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 697187) has the molecular formula C18H19N3S2 and a molecular weight of 341.51 g/mol. Its IUPAC name is 10-[(2,4-dimethylphenyl)methylsulfanyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | 10-[(2,4-dimethylphenyl)methylsulfanyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 697187 |
| Molecular Formula | C18H19N3S2 |
| Molecular Weight | 341.51 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 10-[(2,4-dimethylphenyl)methylsulfanyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | Cc1ccc(CSc2nc(N)c3c4c(sc3n2)CCC4)c(C)c1 |
| InChI | InChI=1S/C18H19N3S2/c1-10-6-7-12(11(2)8-10)9-22-18-20-16(19)15-13-4-3-5-14(13)23-17(15)21-18/h6-8H,3-5,9H2,1-2H3,(H2,19,20,21) |
| InChIKey | OCBGSQZAPPBIGM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |