C35H39N2O7P — CID 3204
2-(N-benzylanilino)ethyl 5-(5,5-dimethyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-yl)-2,4-dimethyl-6-(3-nitrophenyl)cyclohexa-1,4-diene-1-carboxylate (PubChem CID 3204) has the molecular formula C35H39N2O7P and a molecular weight of 630.68 g/mol. Its IUPAC name is 2-(N-benzylanilino)ethyl 5-(5,5-dimethyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-yl)-2,4-dimethyl-6-(3-nitrophenyl)cyclohexa-1,4-diene-1-carboxylate.
| Compound Name | 2-(N-benzylanilino)ethyl 5-(5,5-dimethyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-yl)-2,4-dimethyl-6-(3-nitrophenyl)cyclohexa-1,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 3204 |
| Molecular Formula | C35H39N2O7P |
| Molecular Weight | 630.68 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | 2-(N-benzylanilino)ethyl 5-(5,5-dimethyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-yl)-2,4-dimethyl-6-(3-nitrophenyl)cyclohexa-1,4-diene-1-carboxylate |
| SMILES | CC1=C(C(=O)OCCN(Cc2ccccc2)c2ccccc2)C(c2cccc([N+](=O)[O-])c2)C(P2(=O)OCC(C)(C)CO2)=C(C)C1 |
| InChI | InChI=1S/C35H39N2O7P/c1-25-20-26(2)33(45(41)43-23-35(3,4)24-44-45)32(28-14-11-17-30(21-28)37(39)40)31(25)34(38)42-19-18-36(29-15-9-6-10-16-29)22-27-12-7-5-8-13-27/h5-17,21,32H,18-20,22-24H2,1-4H3 |
| InChIKey | XDFXEZVRDYIFRY-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.68 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|