C25H25ClN6O3 — CID 3204080
1-[2-butyl-7-methyl-3-[(3-nitrophenyl)methyl]imidazo[4,5-b]pyridin-6-yl]-3-(3-chlorophenyl)urea (PubChem CID 3204080) has the molecular formula C25H25ClN6O3 and a molecular weight of 492.97 g/mol. Its IUPAC name is 1-[2-butyl-7-methyl-3-[(3-nitrophenyl)methyl]imidazo[4,5-b]pyridin-6-yl]-3-(3-chlorophenyl)urea.
| Compound Name | 1-[2-butyl-7-methyl-3-[(3-nitrophenyl)methyl]imidazo[4,5-b]pyridin-6-yl]-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 3204080 |
| Molecular Formula | C25H25ClN6O3 |
| Molecular Weight | 492.97 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 1-[2-butyl-7-methyl-3-[(3-nitrophenyl)methyl]imidazo[4,5-b]pyridin-6-yl]-3-(3-chlorophenyl)urea |
| SMILES | CCCCc1nc2c(C)c(NC(=O)Nc3cccc(Cl)c3)cnc2n1Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H25ClN6O3/c1-3-4-11-22-30-23-16(2)21(29-25(33)28-19-9-6-8-18(26)13-19)14-27-24(23)31(22)15-17-7-5-10-20(12-17)32(34)35/h5-10,12-14H,3-4,11,15H2,1-2H3,(H2,28,29,33) |
| InChIKey | SQBHUOXKKPWTOQ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.97 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|