C23H29N5O3 — CID 3204071
N-[2-butyl-7-methyl-3-[(3-nitrophenyl)methyl]imidazo[4,5-b]pyridin-6-yl]-2,2-dimethylpropanamide (PubChem CID 3204071) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is N-[2-butyl-7-methyl-3-[(3-nitrophenyl)methyl]imidazo[4,5-b]pyridin-6-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-butyl-7-methyl-3-[(3-nitrophenyl)methyl]imidazo[4,5-b]pyridin-6-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 3204071 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | N-[2-butyl-7-methyl-3-[(3-nitrophenyl)methyl]imidazo[4,5-b]pyridin-6-yl]-2,2-dimethylpropanamide |
| SMILES | CCCCc1nc2c(C)c(NC(=O)C(C)(C)C)cnc2n1Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H29N5O3/c1-6-7-11-19-26-20-15(2)18(25-22(29)23(3,4)5)13-24-21(20)27(19)14-16-9-8-10-17(12-16)28(30)31/h8-10,12-13H,6-7,11,14H2,1-5H3,(H,25,29) |
| InChIKey | JKJKZYJGFUYXPI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|