C18H21N5O2 — CID 3212391
2-butyl-5-methyl-3-[(3-nitrophenyl)methyl]imidazo[4,5-b]pyridin-6-amine (PubChem CID 3212391) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-butyl-5-methyl-3-[(3-nitrophenyl)methyl]imidazo[4,5-b]pyridin-6-amine.
| Compound Name | 2-butyl-5-methyl-3-[(3-nitrophenyl)methyl]imidazo[4,5-b]pyridin-6-amine |
|---|---|
| PubChem CID | 3212391 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 2-butyl-5-methyl-3-[(3-nitrophenyl)methyl]imidazo[4,5-b]pyridin-6-amine |
| SMILES | CCCCc1nc2cc(N)c(C)nc2n1Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H21N5O2/c1-3-4-8-17-21-16-10-15(19)12(2)20-18(16)22(17)11-13-6-5-7-14(9-13)23(24)25/h5-7,9-10H,3-4,8,11,19H2,1-2H3 |
| InChIKey | JRNDMXGPEAFCLQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|