C23H24FN3O5S — CID 3206862
2-(N-[2-(benzenesulfonamido)acetyl]-4-fluoroanilino)-N-(furan-2-ylmethyl)butanamide (PubChem CID 3206862) has the molecular formula C23H24FN3O5S and a molecular weight of 473.53 g/mol. Its IUPAC name is 2-(N-[2-(benzenesulfonamido)acetyl]-4-fluoroanilino)-N-(furan-2-ylmethyl)butanamide.
| Compound Name | 2-(N-[2-(benzenesulfonamido)acetyl]-4-fluoroanilino)-N-(furan-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 3206862 |
| Molecular Formula | C23H24FN3O5S |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 2-(N-[2-(benzenesulfonamido)acetyl]-4-fluoroanilino)-N-(furan-2-ylmethyl)butanamide |
| SMILES | CCC(C(=O)NCc1ccco1)N(C(=O)CNS(=O)(=O)c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H24FN3O5S/c1-2-21(23(29)25-15-19-7-6-14-32-19)27(18-12-10-17(24)11-13-18)22(28)16-26-33(30,31)20-8-4-3-5-9-20/h3-14,21,26H,2,15-16H2,1H3,(H,25,29) |
| InChIKey | WGQOJRCIYQUUOA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |