C21H19F3N2OS — CID 3207972
2-(3-ethyl-8-methylquinolin-2-yl)sulfanyl-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 3207972) has the molecular formula C21H19F3N2OS and a molecular weight of 404.46 g/mol. Its IUPAC name is 2-(3-ethyl-8-methylquinolin-2-yl)sulfanyl-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(3-ethyl-8-methylquinolin-2-yl)sulfanyl-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3207972 |
| Molecular Formula | C21H19F3N2OS |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-(3-ethyl-8-methylquinolin-2-yl)sulfanyl-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCc1cc2cccc(C)c2nc1SCC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H19F3N2OS/c1-3-14-11-15-8-6-7-13(2)19(15)26-20(14)28-12-18(27)25-17-10-5-4-9-16(17)21(22,23)24/h4-11H,3,12H2,1-2H3,(H,25,27) |
| InChIKey | QTXASVASRAWSQM-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |