C14H14NO2S- — CID 7383523
2-(3-ethyl-8-methylquinolin-2-yl)sulfanylacetate (PubChem CID 7383523) has the molecular formula C14H14NO2S- and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-(3-ethyl-8-methylquinolin-2-yl)sulfanylacetate.
| Compound Name | 2-(3-ethyl-8-methylquinolin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 7383523 |
| Molecular Formula | C14H14NO2S- |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2-(3-ethyl-8-methylquinolin-2-yl)sulfanylacetate |
| SMILES | CCc1cc2cccc(C)c2nc1SCC(=O)[O-] |
| InChI | InChI=1S/C14H15NO2S/c1-3-10-7-11-6-4-5-9(2)13(11)15-14(10)18-8-12(16)17/h4-7H,3,8H2,1-2H3,(H,16,17)/p-1 |
| InChIKey | DQFDILJIKIXOGQ-UHFFFAOYSA-M |
| XLogP | 1.95 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |