C20H21N3O3S — CID 3208186
N'-[2-(3-ethyl-5,8-dimethylquinolin-2-yl)sulfanylacetyl]furan-2-carbohydrazide (PubChem CID 3208186) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is N'-[2-(3-ethyl-5,8-dimethylquinolin-2-yl)sulfanylacetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-(3-ethyl-5,8-dimethylquinolin-2-yl)sulfanylacetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 3208186 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N'-[2-(3-ethyl-5,8-dimethylquinolin-2-yl)sulfanylacetyl]furan-2-carbohydrazide |
| SMILES | CCc1cc2c(C)ccc(C)c2nc1SCC(=O)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C20H21N3O3S/c1-4-14-10-15-12(2)7-8-13(3)18(15)21-20(14)27-11-17(24)22-23-19(25)16-6-5-9-26-16/h5-10H,4,11H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | AYKBKCHZELIITG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|