C20H19N3O5S — CID 3208350
N'-[2-[(8-ethyl-2,3-dihydro-[1,4]dioxino[2,3-g]quinolin-7-yl)sulfanyl]acetyl]furan-2-carbohydrazide (PubChem CID 3208350) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is N'-[2-[(8-ethyl-2,3-dihydro-[1,4]dioxino[2,3-g]quinolin-7-yl)sulfanyl]acetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-[(8-ethyl-2,3-dihydro-[1,4]dioxino[2,3-g]quinolin-7-yl)sulfanyl]acetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 3208350 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | N'-[2-[(8-ethyl-2,3-dihydro-[1,4]dioxino[2,3-g]quinolin-7-yl)sulfanyl]acetyl]furan-2-carbohydrazide |
| SMILES | CCc1cc2cc3c(cc2nc1SCC(=O)NNC(=O)c1ccco1)OCCO3 |
| InChI | InChI=1S/C20H19N3O5S/c1-2-12-8-13-9-16-17(28-7-6-27-16)10-14(13)21-20(12)29-11-18(24)22-23-19(25)15-4-3-5-26-15/h3-5,8-10H,2,6-7,11H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | YMVKRJONAIUHIP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|