C21H27N3O3S — CID 3208084
N'-[2-(3-ethyl-7-methoxyquinolin-2-yl)sulfanylacetyl]cyclohexanecarbohydrazide (PubChem CID 3208084) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is N'-[2-(3-ethyl-7-methoxyquinolin-2-yl)sulfanylacetyl]cyclohexanecarbohydrazide.
| Compound Name | N'-[2-(3-ethyl-7-methoxyquinolin-2-yl)sulfanylacetyl]cyclohexanecarbohydrazide |
|---|---|
| PubChem CID | 3208084 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N'-[2-(3-ethyl-7-methoxyquinolin-2-yl)sulfanylacetyl]cyclohexanecarbohydrazide |
| SMILES | CCc1cc2ccc(OC)cc2nc1SCC(=O)NNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C21H27N3O3S/c1-3-14-11-16-9-10-17(27-2)12-18(16)22-21(14)28-13-19(25)23-24-20(26)15-7-5-4-6-8-15/h9-12,15H,3-8,13H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | QAIBJNMQIWQCAK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|