C19H23ClN2O2 — CID 3216900
N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-N-(2-methoxyethyl)cyclopropanecarboxamide (PubChem CID 3216900) has the molecular formula C19H23ClN2O2 and a molecular weight of 346.86 g/mol. Its IUPAC name is N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-N-(2-methoxyethyl)cyclopropanecarboxamide.
| Compound Name | N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-N-(2-methoxyethyl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 3216900 |
| Molecular Formula | C19H23ClN2O2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-N-(2-methoxyethyl)cyclopropanecarboxamide |
| SMILES | COCCN(Cc1cc2ccc(C)c(C)c2nc1Cl)C(=O)C1CC1 |
| InChI | InChI=1S/C19H23ClN2O2/c1-12-4-5-15-10-16(18(20)21-17(15)13(12)2)11-22(8-9-24-3)19(23)14-6-7-14/h4-5,10,14H,6-9,11H2,1-3H3 |
| InChIKey | BUTXRZDNIVKVJC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|