C21H31N3OS — CID 3218727
N-[1-[(2,3-dimethylphenyl)carbamothioyl]piperidin-4-yl]cyclohexanecarboxamide (PubChem CID 3218727) has the molecular formula C21H31N3OS and a molecular weight of 373.57 g/mol. Its IUPAC name is N-[1-[(2,3-dimethylphenyl)carbamothioyl]piperidin-4-yl]cyclohexanecarboxamide.
| Compound Name | N-[1-[(2,3-dimethylphenyl)carbamothioyl]piperidin-4-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 3218727 |
| Molecular Formula | C21H31N3OS |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | N-[1-[(2,3-dimethylphenyl)carbamothioyl]piperidin-4-yl]cyclohexanecarboxamide |
| SMILES | Cc1cccc(NC(=S)N2CCC(NC(=O)C3CCCCC3)CC2)c1C |
| InChI | InChI=1S/C21H31N3OS/c1-15-7-6-10-19(16(15)2)23-21(26)24-13-11-18(12-14-24)22-20(25)17-8-4-3-5-9-17/h6-7,10,17-18H,3-5,8-9,11-14H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | TZOLQZAODOPOMC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|