C19H31N3S — CID 3482051
4-[butan-2-yl(methyl)amino]-N-(2,3-dimethylphenyl)piperidine-1-carbothioamide (PubChem CID 3482051) has the molecular formula C19H31N3S and a molecular weight of 333.55 g/mol. Its IUPAC name is 4-[butan-2-yl(methyl)amino]-N-(2,3-dimethylphenyl)piperidine-1-carbothioamide.
| Compound Name | 4-[butan-2-yl(methyl)amino]-N-(2,3-dimethylphenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3482051 |
| Molecular Formula | C19H31N3S |
| Molecular Weight | 333.55 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 4-[butan-2-yl(methyl)amino]-N-(2,3-dimethylphenyl)piperidine-1-carbothioamide |
| SMILES | CCC(C)N(C)C1CCN(C(=S)Nc2cccc(C)c2C)CC1 |
| InChI | InChI=1S/C19H31N3S/c1-6-15(3)21(5)17-10-12-22(13-11-17)19(23)20-18-9-7-8-14(2)16(18)4/h7-9,15,17H,6,10-13H2,1-5H3,(H,20,23) |
| InChIKey | ZMLHZUATQHYUIZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|