C19H24N4OS2 — CID 3223637
N-(oxolan-2-ylmethyl)-4-(4-phenyl-1,3-thiazol-2-yl)piperazine-1-carbothioamide (PubChem CID 3223637) has the molecular formula C19H24N4OS2 and a molecular weight of 388.56 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-4-(4-phenyl-1,3-thiazol-2-yl)piperazine-1-carbothioamide.
| Compound Name | N-(oxolan-2-ylmethyl)-4-(4-phenyl-1,3-thiazol-2-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3223637 |
| Molecular Formula | C19H24N4OS2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-4-(4-phenyl-1,3-thiazol-2-yl)piperazine-1-carbothioamide |
| SMILES | S=C(NCC1CCCO1)N1CCN(c2nc(-c3ccccc3)cs2)CC1 |
| InChI | InChI=1S/C19H24N4OS2/c25-18(20-13-16-7-4-12-24-16)22-8-10-23(11-9-22)19-21-17(14-26-19)15-5-2-1-3-6-15/h1-3,5-6,14,16H,4,7-13H2,(H,20,25) |
| InChIKey | ACSLIDFTZZIDFE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|