C13H13FN2OS — CID 683402
4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]morpholine (PubChem CID 683402) has the molecular formula C13H13FN2OS and a molecular weight of 264.32 g/mol. Its IUPAC name is 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]morpholine.
| Compound Name | 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]morpholine |
|---|---|
| PubChem CID | 683402 |
| Molecular Formula | C13H13FN2OS |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]morpholine |
| SMILES | Fc1ccc(-c2csc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C13H13FN2OS/c14-11-3-1-10(2-4-11)12-9-18-13(15-12)16-5-7-17-8-6-16/h1-4,9H,5-8H2 |
| InChIKey | ZRUYUEXEWVXEDR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |