C18H19FN2OS — CID 3225394
N-butyl-4-[(4-fluorophenyl)methyl]thieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 3225394) has the molecular formula C18H19FN2OS and a molecular weight of 330.43 g/mol. Its IUPAC name is N-butyl-4-[(4-fluorophenyl)methyl]thieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | N-butyl-4-[(4-fluorophenyl)methyl]thieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 3225394 |
| Molecular Formula | C18H19FN2OS |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-butyl-4-[(4-fluorophenyl)methyl]thieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | CCCCNC(=O)c1cc2sccc2n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H19FN2OS/c1-2-3-9-20-18(22)16-11-17-15(8-10-23-17)21(16)12-13-4-6-14(19)7-5-13/h4-8,10-11H,2-3,9,12H2,1H3,(H,20,22) |
| InChIKey | IOMIDLQQJUAEFL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|