C24H31FN3OS+ — CID 7437617
N-[3-[(2R,6R)-2,6-dimethylpiperidin-1-ium-1-yl]propyl]-4-[(4-fluorophenyl)methyl]thieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 7437617) has the molecular formula C24H31FN3OS+ and a molecular weight of 428.60 g/mol. Its IUPAC name is N-[3-[(2R,6R)-2,6-dimethylpiperidin-1-ium-1-yl]propyl]-4-[(4-fluorophenyl)methyl]thieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | N-[3-[(2R,6R)-2,6-dimethylpiperidin-1-ium-1-yl]propyl]-4-[(4-fluorophenyl)methyl]thieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 7437617 |
| Molecular Formula | C24H31FN3OS+ |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | N-[3-[(2R,6R)-2,6-dimethylpiperidin-1-ium-1-yl]propyl]-4-[(4-fluorophenyl)methyl]thieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | C[C@@H]1CCC[C@@H](C)[NH+]1CCCNC(=O)c1cc2sccc2n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C24H30FN3OS/c1-17-5-3-6-18(2)27(17)13-4-12-26-24(29)22-15-23-21(11-14-30-23)28(22)16-19-7-9-20(25)10-8-19/h7-11,14-15,17-18H,3-6,12-13,16H2,1-2H3,(H,26,29)/p+1/t17-,18-/m1/s1 |
| InChIKey | FMOSXWGMOAQLCW-QZTJIDSGSA-O |
| XLogP | 3.86 |
| TPSA | 38.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|