C12H16N2OS — CID 3695779
N-butyl-4-methylthieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 3695779) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is N-butyl-4-methylthieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | N-butyl-4-methylthieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 3695779 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | N-butyl-4-methylthieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | CCCCNC(=O)c1cc2sccc2n1C |
| InChI | InChI=1S/C12H16N2OS/c1-3-4-6-13-12(15)10-8-11-9(14(10)2)5-7-16-11/h5,7-8H,3-4,6H2,1-2H3,(H,13,15) |
| InChIKey | AHDHCOUOCMWNML-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|