C20H22N4OS — CID 3227731
2-[[3-(1H-benzimidazol-2-yl)-2-pyridinyl]sulfanyl]-1-(2-methylpiperidin-1-yl)ethanone (PubChem CID 3227731) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 2-[[3-(1H-benzimidazol-2-yl)-2-pyridinyl]sulfanyl]-1-(2-methylpiperidin-1-yl)ethanone.
| Compound Name | 2-[[3-(1H-benzimidazol-2-yl)-2-pyridinyl]sulfanyl]-1-(2-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 3227731 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-[[3-(1H-benzimidazol-2-yl)-2-pyridinyl]sulfanyl]-1-(2-methylpiperidin-1-yl)ethanone |
| SMILES | CC1CCCCN1C(=O)CSc1ncccc1-c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H22N4OS/c1-14-7-4-5-12-24(14)18(25)13-26-20-15(8-6-11-21-20)19-22-16-9-2-3-10-17(16)23-19/h2-3,6,8-11,14H,4-5,7,12-13H2,1H3,(H,22,23) |
| InChIKey | MNOVGYVKZPQQDX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |