C21H24N4OS — CID 1432571
2-[[3-(1H-benzimidazol-2-yl)-2-pyridinyl]sulfanyl]-1-[(2R)-2-ethylpiperidin-1-yl]ethanone (PubChem CID 1432571) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is 2-[[3-(1H-benzimidazol-2-yl)-2-pyridinyl]sulfanyl]-1-[(2R)-2-ethylpiperidin-1-yl]ethanone.
| Compound Name | 2-[[3-(1H-benzimidazol-2-yl)-2-pyridinyl]sulfanyl]-1-[(2R)-2-ethylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 1432571 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-[[3-(1H-benzimidazol-2-yl)-2-pyridinyl]sulfanyl]-1-[(2R)-2-ethylpiperidin-1-yl]ethanone |
| SMILES | CC[C@@H]1CCCCN1C(=O)CSc1ncccc1-c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H24N4OS/c1-2-15-8-5-6-13-25(15)19(26)14-27-21-16(9-7-12-22-21)20-23-17-10-3-4-11-18(17)24-20/h3-4,7,9-12,15H,2,5-6,8,13-14H2,1H3,(H,23,24)/t15-/m1/s1 |
| InChIKey | MBNYGYSQZOFYIB-OAHLLOKOSA-N |
| XLogP | 4.51 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |