C24H26N6O2 — CID 3227835
ethyl 4-[(3-benzyl-5-butyltriazolo[4,5-d]pyrimidin-7-yl)amino]benzoate (PubChem CID 3227835) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is ethyl 4-[(3-benzyl-5-butyltriazolo[4,5-d]pyrimidin-7-yl)amino]benzoate.
| Compound Name | ethyl 4-[(3-benzyl-5-butyltriazolo[4,5-d]pyrimidin-7-yl)amino]benzoate |
|---|---|
| PubChem CID | 3227835 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | ethyl 4-[(3-benzyl-5-butyltriazolo[4,5-d]pyrimidin-7-yl)amino]benzoate |
| SMILES | CCCCc1nc(Nc2ccc(C(=O)OCC)cc2)c2nnn(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C24H26N6O2/c1-3-5-11-20-26-22(25-19-14-12-18(13-15-19)24(31)32-4-2)21-23(27-20)30(29-28-21)16-17-9-7-6-8-10-17/h6-10,12-15H,3-5,11,16H2,1-2H3,(H,25,26,27) |
| InChIKey | NKDBLKGGIPIFLV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |