C18H28N6 — CID 3229125
4-[[1-(2-methylbutan-2-yl)tetrazol-5-yl]-(4-methylpiperidin-1-yl)methyl]pyridine (PubChem CID 3229125) has the molecular formula C18H28N6 and a molecular weight of 328.46 g/mol. Its IUPAC name is 4-[[1-(2-methylbutan-2-yl)tetrazol-5-yl]-(4-methylpiperidin-1-yl)methyl]pyridine.
| Compound Name | 4-[[1-(2-methylbutan-2-yl)tetrazol-5-yl]-(4-methylpiperidin-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 3229125 |
| Molecular Formula | C18H28N6 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 4-[[1-(2-methylbutan-2-yl)tetrazol-5-yl]-(4-methylpiperidin-1-yl)methyl]pyridine |
| SMILES | CCC(C)(C)n1nnnc1C(c1ccncc1)N1CCC(C)CC1 |
| InChI | InChI=1S/C18H28N6/c1-5-18(3,4)24-17(20-21-22-24)16(15-6-10-19-11-7-15)23-12-8-14(2)9-13-23/h6-7,10-11,14,16H,5,8-9,12-13H2,1-4H3 |
| InChIKey | IFAFCECVQPUVJH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |