C28H32ClN3OS — CID 3229830
2-[5-(4-chlorophenyl)-1-cyclopentylimidazol-2-yl]sulfanyl-N-(4-cyclohexylphenyl)acetamide (PubChem CID 3229830) has the molecular formula C28H32ClN3OS and a molecular weight of 494.10 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-1-cyclopentylimidazol-2-yl]sulfanyl-N-(4-cyclohexylphenyl)acetamide.
| Compound Name | 2-[5-(4-chlorophenyl)-1-cyclopentylimidazol-2-yl]sulfanyl-N-(4-cyclohexylphenyl)acetamide |
|---|---|
| PubChem CID | 3229830 |
| Molecular Formula | C28H32ClN3OS |
| Molecular Weight | 494.10 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-1-cyclopentylimidazol-2-yl]sulfanyl-N-(4-cyclohexylphenyl)acetamide |
| SMILES | O=C(CSc1ncc(-c2ccc(Cl)cc2)n1C1CCCC1)Nc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C28H32ClN3OS/c29-23-14-10-22(11-15-23)26-18-30-28(32(26)25-8-4-5-9-25)34-19-27(33)31-24-16-12-21(13-17-24)20-6-2-1-3-7-20/h10-18,20,25H,1-9,19H2,(H,31,33) |
| InChIKey | KVLLKXWBUISTMH-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.10 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |