C24H25N3O2S — CID 3134282
2-[1-(cyclohexanecarbonyl)-5-phenylimidazol-2-yl]sulfanyl-N-phenylacetamide (PubChem CID 3134282) has the molecular formula C24H25N3O2S and a molecular weight of 419.55 g/mol. Its IUPAC name is 2-[1-(cyclohexanecarbonyl)-5-phenylimidazol-2-yl]sulfanyl-N-phenylacetamide.
| Compound Name | 2-[1-(cyclohexanecarbonyl)-5-phenylimidazol-2-yl]sulfanyl-N-phenylacetamide |
|---|---|
| PubChem CID | 3134282 |
| Molecular Formula | C24H25N3O2S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 2-[1-(cyclohexanecarbonyl)-5-phenylimidazol-2-yl]sulfanyl-N-phenylacetamide |
| SMILES | O=C(CSc1ncc(-c2ccccc2)n1C(=O)C1CCCCC1)Nc1ccccc1 |
| InChI | InChI=1S/C24H25N3O2S/c28-22(26-20-14-8-3-9-15-20)17-30-24-25-16-21(18-10-4-1-5-11-18)27(24)23(29)19-12-6-2-7-13-19/h1,3-5,8-11,14-16,19H,2,6-7,12-13,17H2,(H,26,28) |
| InChIKey | KNRMPHWQFXWEBK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |