C15H21N5O2 — CID 3230999
N-[2-(dimethylamino)ethyl]-1-[(3-methoxyphenyl)methyl]triazole-4-carboxamide (PubChem CID 3230999) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-1-[(3-methoxyphenyl)methyl]triazole-4-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-1-[(3-methoxyphenyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 3230999 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-1-[(3-methoxyphenyl)methyl]triazole-4-carboxamide |
| SMILES | COc1cccc(Cn2cc(C(=O)NCCN(C)C)nn2)c1 |
| InChI | InChI=1S/C15H21N5O2/c1-19(2)8-7-16-15(21)14-11-20(18-17-14)10-12-5-4-6-13(9-12)22-3/h4-6,9,11H,7-8,10H2,1-3H3,(H,16,21) |
| InChIKey | KLEPBMAIZWVISP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |