C27H28FN5O2 — CID 3232133
N-[4-(4-ethylpiperazin-1-yl)phenyl]-1-[(4-fluorophenyl)methyl]-2-oxo-3H-benzimidazole-5-carboxamide (PubChem CID 3232133) has the molecular formula C27H28FN5O2 and a molecular weight of 473.55 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)phenyl]-1-[(4-fluorophenyl)methyl]-2-oxo-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-1-[(4-fluorophenyl)methyl]-2-oxo-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 3232133 |
| Molecular Formula | C27H28FN5O2 |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-1-[(4-fluorophenyl)methyl]-2-oxo-3H-benzimidazole-5-carboxamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3ccc4c(c3)[nH]c(=O)n4Cc3ccc(F)cc3)cc2)CC1 |
| InChI | InChI=1S/C27H28FN5O2/c1-2-31-13-15-32(16-14-31)23-10-8-22(9-11-23)29-26(34)20-5-12-25-24(17-20)30-27(35)33(25)18-19-3-6-21(28)7-4-19/h3-12,17H,2,13-16,18H2,1H3,(H,29,34)(H,30,35) |
| InChIKey | IYMDSLHIXBZRAR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 73.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|