C19H16N4O3S — CID 3232612
2-methoxy-6-(4-methoxyphenyl)-8-(thiophen-2-ylmethyl)pteridin-7-one (PubChem CID 3232612) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is 2-methoxy-6-(4-methoxyphenyl)-8-(thiophen-2-ylmethyl)pteridin-7-one.
| Compound Name | 2-methoxy-6-(4-methoxyphenyl)-8-(thiophen-2-ylmethyl)pteridin-7-one |
|---|---|
| PubChem CID | 3232612 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 2-methoxy-6-(4-methoxyphenyl)-8-(thiophen-2-ylmethyl)pteridin-7-one |
| SMILES | COc1ccc(-c2nc3cnc(OC)nc3n(Cc3cccs3)c2=O)cc1 |
| InChI | InChI=1S/C19H16N4O3S/c1-25-13-7-5-12(6-8-13)16-18(24)23(11-14-4-3-9-27-14)17-15(21-16)10-20-19(22-17)26-2/h3-10H,11H2,1-2H3 |
| InChIKey | JHDBQQVGAVUIKM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |