C24H25N5O2 — CID 3232624
2-(dimethylamino)-8-[(3-methoxyphenyl)methyl]-6-(2-phenylethyl)pteridin-7-one (PubChem CID 3232624) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 2-(dimethylamino)-8-[(3-methoxyphenyl)methyl]-6-(2-phenylethyl)pteridin-7-one.
| Compound Name | 2-(dimethylamino)-8-[(3-methoxyphenyl)methyl]-6-(2-phenylethyl)pteridin-7-one |
|---|---|
| PubChem CID | 3232624 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 2-(dimethylamino)-8-[(3-methoxyphenyl)methyl]-6-(2-phenylethyl)pteridin-7-one |
| SMILES | COc1cccc(Cn2c(=O)c(CCc3ccccc3)nc3cnc(N(C)C)nc32)c1 |
| InChI | InChI=1S/C24H25N5O2/c1-28(2)24-25-15-21-22(27-24)29(16-18-10-7-11-19(14-18)31-3)23(30)20(26-21)13-12-17-8-5-4-6-9-17/h4-11,14-15H,12-13,16H2,1-3H3 |
| InChIKey | JXCOICYQIJLGIS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |