C23H24N6O2S — CID 3232597
6-(4-methoxyphenyl)-2-(4-methylpiperazin-1-yl)-8-(thiophen-2-ylmethyl)pteridin-7-one (PubChem CID 3232597) has the molecular formula C23H24N6O2S and a molecular weight of 448.55 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-2-(4-methylpiperazin-1-yl)-8-(thiophen-2-ylmethyl)pteridin-7-one.
| Compound Name | 6-(4-methoxyphenyl)-2-(4-methylpiperazin-1-yl)-8-(thiophen-2-ylmethyl)pteridin-7-one |
|---|---|
| PubChem CID | 3232597 |
| Molecular Formula | C23H24N6O2S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 6-(4-methoxyphenyl)-2-(4-methylpiperazin-1-yl)-8-(thiophen-2-ylmethyl)pteridin-7-one |
| SMILES | COc1ccc(-c2nc3cnc(N4CCN(C)CC4)nc3n(Cc3cccs3)c2=O)cc1 |
| InChI | InChI=1S/C23H24N6O2S/c1-27-9-11-28(12-10-27)23-24-14-19-21(26-23)29(15-18-4-3-13-32-18)22(30)20(25-19)16-5-7-17(31-2)8-6-16/h3-8,13-14H,9-12,15H2,1-2H3 |
| InChIKey | SNLMTJVYLGLPNX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |