C25H25N5O4 — CID 3234621
6-(4-methoxyphenyl)-8-[(3-methoxyphenyl)methyl]-2-morpholin-4-ylpteridin-7-one (PubChem CID 3234621) has the molecular formula C25H25N5O4 and a molecular weight of 459.51 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-8-[(3-methoxyphenyl)methyl]-2-morpholin-4-ylpteridin-7-one.
| Compound Name | 6-(4-methoxyphenyl)-8-[(3-methoxyphenyl)methyl]-2-morpholin-4-ylpteridin-7-one |
|---|---|
| PubChem CID | 3234621 |
| Molecular Formula | C25H25N5O4 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 6-(4-methoxyphenyl)-8-[(3-methoxyphenyl)methyl]-2-morpholin-4-ylpteridin-7-one |
| SMILES | COc1ccc(-c2nc3cnc(N4CCOCC4)nc3n(Cc3cccc(OC)c3)c2=O)cc1 |
| InChI | InChI=1S/C25H25N5O4/c1-32-19-8-6-18(7-9-19)22-24(31)30(16-17-4-3-5-20(14-17)33-2)23-21(27-22)15-26-25(28-23)29-10-12-34-13-11-29/h3-9,14-15H,10-13,16H2,1-2H3 |
| InChIKey | REPOWFBDBMKKKM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 91.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |