C21H18N4O4 — CID 3232827
2-methoxy-6,8-bis(4-methoxyphenyl)pteridin-7-one (PubChem CID 3232827) has the molecular formula C21H18N4O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is 2-methoxy-6,8-bis(4-methoxyphenyl)pteridin-7-one.
| Compound Name | 2-methoxy-6,8-bis(4-methoxyphenyl)pteridin-7-one |
|---|---|
| PubChem CID | 3232827 |
| Molecular Formula | C21H18N4O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2-methoxy-6,8-bis(4-methoxyphenyl)pteridin-7-one |
| SMILES | COc1ccc(-c2nc3cnc(OC)nc3n(-c3ccc(OC)cc3)c2=O)cc1 |
| InChI | InChI=1S/C21H18N4O4/c1-27-15-8-4-13(5-9-15)18-20(26)25(14-6-10-16(28-2)11-7-14)19-17(23-18)12-22-21(24-19)29-3/h4-12H,1-3H3 |
| InChIKey | RBSBKGUZQXFDHP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |