C20H15N3O2S — CID 3232621
6-(1,3-benzodioxol-5-yl)-N-(thiophen-2-ylmethyl)quinazolin-4-amine (PubChem CID 3232621) has the molecular formula C20H15N3O2S and a molecular weight of 361.43 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-N-(thiophen-2-ylmethyl)quinazolin-4-amine.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-N-(thiophen-2-ylmethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 3232621 |
| Molecular Formula | C20H15N3O2S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-N-(thiophen-2-ylmethyl)quinazolin-4-amine |
| SMILES | c1csc(CNc2ncnc3ccc(-c4ccc5c(c4)OCO5)cc23)c1 |
| InChI | InChI=1S/C20H15N3O2S/c1-2-15(26-7-1)10-21-20-16-8-13(3-5-17(16)22-11-23-20)14-4-6-18-19(9-14)25-12-24-18/h1-9,11H,10,12H2,(H,21,22,23) |
| InChIKey | QFBOPHGXTBOQRN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |