C23H19N3O2 — CID 3234028
6-(1,3-benzodioxol-5-yl)-N-[(3-methylphenyl)methyl]quinazolin-4-amine (PubChem CID 3234028) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-N-[(3-methylphenyl)methyl]quinazolin-4-amine.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-N-[(3-methylphenyl)methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 3234028 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-N-[(3-methylphenyl)methyl]quinazolin-4-amine |
| SMILES | Cc1cccc(CNc2ncnc3ccc(-c4ccc5c(c4)OCO5)cc23)c1 |
| InChI | InChI=1S/C23H19N3O2/c1-15-3-2-4-16(9-15)12-24-23-19-10-17(5-7-20(19)25-13-26-23)18-6-8-21-22(11-18)28-14-27-21/h2-11,13H,12,14H2,1H3,(H,24,25,26) |
| InChIKey | KUOAPNBMHMTFAQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |